Inhibitor Report for: Zeatin
Zeatin | Type | Not A/B H target |
| | Natural |
| | Purine |
| Other_Name (7) |
| Chemical_Nomenclature | 2-methyl-4-(1H-purine-6-ylamino)-2-buten-1-ol |
| Formula | C10H13N5O |
| CAS_number | 1637-39-4 |
| | 32771-64-5 |
| MW | 219 |
| |
| Paper | Heo_2002_Mol.Cells_13_113 |
| Comment | Derivative of purine Adenine, purified from Fiatoua villosa. |
| | An aminopurine factor in plant extracts that induces cell division. Poor AChE inhibitor |
| CID | 15419 |
| | 449093 |
| Family | ACHE |
| InChIKey | UZKQTCBAMSWPJD-UHFFFAOYSA-N |
| | UZKQTCBAMSWPJD-FARCUNLSSA-N |
| CanonicalSMILES | CC(=CCNC1=NC=NC2=C1NC=N2)CO |
| InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15) |
| | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
| Wikipedia | Zeatin |
|
|