Substrate Report for: VPA-glucuronide
VPA-glucuronide | Type | Glucuronide |
| Other_Name (6) |
| Chemical_Nomenclature | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-propylpentanoyloxy)oxane-2-carboxylic acid |
| Formula | C14H24O8 |
| CAS_number | 60113-83-9 |
| MW | 320.34 |
| |
| Paper | Suzuki_2010_Drug.Metab.Dispos_38_1538 |
| | Masuo_2010_Drug.Metab.Dispos_38_1828 |
| | Nakamura_2008_Drug.Metab.Lett_2_280 |
| | Mori_2007_Drug.Metab.Rev_39_647 |
| Comment | ACPH_Peptidase_S9: VPA-glucuronidase is responsible for maintaining the serum concentration of VPA, by cleaving its major metabolic product, valproic acid-beta-(d)-glucuronide (VPA-G),2 releasing VPA allowing its reabsorption. This enzyme is inhibited by carbapenems |
| Gene_locus | pig-acph |
| CID | 88111 |
| Family | ACPH_Peptidase_S9 |
| InChIKey | XXKSYIHWRBBHIC-JVWRJRKNSA-N |
| CanonicalSMILES | CCCC(CCC)C(=O)OC1C(C(C(C(O1)C(=O)O)O)O)O |
| InChI | InChI=1S/C14H24O8/c1-3-5-7(6-4-2)13(20)22-14-10(17)8(15)9(16)11(21-14)12(18)19/h7-11,14-17H,3-6H2,1-2H3,(H,18,19)/t8-,9-,10+,11-,14-/m0/s1 |
|
|