Inhibitor Report for: Tz2
Tz2 | Type | Acridine |
| | Derivative of Tacrine |
| | Azido |
| Other_Name | 1-Azido-ethyl-2-amino-N'-9'-(1',2',3'4,'-tetrahydroacridinyl) hydrochloride |
| Chemical_Nomenclature | N-(2-azidoethyl)-1,2,3,4-tetrahydroacridin-9-amine |
| Formula | C15H17N5 |
| MW | 267.33 |
| |
| Paper | Bourne_2016_J.Am.Chem.Soc_138_1611 |
| | Bourne_2004_Proc.Natl.Acad.Sci.U.S.A_101_1449 |
| | Lewis_2002_Angew.Chem.Int.Ed.Engl_41_875 |
| | Lewis_2002_Angew.Chem.Int.Ed.Engl_41_1053 |
| Structure | 5EIH |
| | 5EIE |
| Comment | AChE Active site inhibitor (tacrine) equipped with an azide group at the end of a methylene chain used as building block of 1,3-dipolar cycloaddition (click chemistry) with a PAS inhibitor (phenylphenanthridinium) equipped with an acatylene group at the end of a flexible methylene chain |
| Gene_locus | mouse-ACHE |
| CID | 86032728 |
| Family | ACHE |
| InChIKey | ANJRGTMSMVLPLB-UHFFFAOYSA-N |
| CanonicalSMILES | C1CCC2=NC3=CC=CC=C3C(=C2C1)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C15H17N5/c16-20-18-10-9-17-15-11-5-1-3-7-13(11)19-14-8-4-2-6-12(14)15/h1,3,5,7H,2,4,6,8-10H2,(H,17,19) |
|
|