Inhibitor Report for: Tacrine-Resveratrol-12
| Tacrine-Resveratrol-12 | Type | Multitarget |
|---|
| | Antioxidant |
| | Derivative of Tacrine |
| Other_Name | (E)-5-(4-((6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino)styryl)benzene-1,3-diol |
| | CHEMBL4081795 |
| Chemical_Nomenclature | 5-[(E)-2-[4-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]phenyl]ethenyl]benzene-1,3-diol |
| Formula | C27H23ClN2O2 |
| MW | 442.94 |
|  |
| Paper | Jerabek_2016_Eur.J.Med.Chem_127_250 |
| Comment | Association of the structural features of the cholinesterase inhibitor drug tacrine with that of resveratrol, which is known for its antioxidant and anti-neuroinflammatory activities. IC50 AChE= 8.8 microM |
| CID | 132278810 |
| Family | ACHE |
| InChIKey | XZNDKAUHJQWCTR-AATRIKPKSA-N |
| CanonicalSMILES | C1CCC2=NC3=C(C=CC(=C3)Cl)C(=C2C1)NC4=CC=C(C=C4)C=CC5=CC(=CC(=C5)O)O |
| InChI | InChI=1S/C27H23ClN2O2/c28-19-9-12-24-26(15-19)30-25-4-2-1-3-23(25)27(24)29-20-10-7-17(8-11-20)5-6-18-13-21(31)16-22(32)14-18/h5-16,31-32H,1-4H2,(H,29,30)/b6-5+ |
|
|
|
