Inhibitor Report for: Solanine
Solanine | Type | Natural |
| | Alkaloid |
| | Carbohydrate |
| | Glycoside |
| Other_Name (7) |
| Chemical_Nomenclature | beta-D-Glucopyranoside, (3beta)-solanid-5-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-2)-O-(6-deoxy-alpha-L-mannopyranosyl-(1-4)) |
| Formula | C45H73NO15 |
| CAS_number | 20562-02-1 |
| MW | 868.1 |
| |
| Kinetic_parameter (24) |
| Paper (12) |
| Comment | A trisaccharide,consisting of glucose,galactose and rhamnose linked to solanidine(glucose 2rhamnose for chaconine) purified from potato sprouts. CAS 20562-03-02 C45H73NO14 alpha-chaconine ; CAS 20562-02-1 ,C45H73NO15 Solanine |
| Kin_Inhibitor | Solanine |
| CID | 262500. alpha-Solanine is found in alcoholic beverages. alpha-Solanine is an alkaloid from potato (Solanum tuberosum) and very many other Solanum species (Solanaceae). Responsible for the teratogenicity of sprouting potatoes |
| | 262500 |
| Family | BCHE |
| InChIKey | ZGVSETXHNHBTRK-UHFFFAOYSA-N |
| CanonicalSMILES | CC1CCC2C(C3C(N2C1)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(C(O8)CO)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C |
| InChI | InChI=1S/C45H73NO15/c1-19-6-9-27-20(2)31-28(46(27)16-19)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)57-43-40(61-41-37(54)35(52)32(49)21(3)56-41)39(34(51)30(18-48)59-43)60-42-38(55)36(53)33(50)29(17-47)58-42/h7,19-21,23-43,47-55H,6,8-18H2,1-5H3 |
|
|