Substrate Report for: PHBV
PHBV | Type | Natural |
| | Polymer |
| | Polyhydroxyalkanoate |
| Other_Name (7) |
| Chemical_Nomenclature | 3-hydroxybutanoic acid;3-hydroxypentanoic acid |
| Formula | C9H18O6 (value for monomer) |
| MW | 222.23 (value for monomer) |
| |
| Paper | Garcia-Hidalgo_2013_PLoS.One_8_e71699 |
| | Biundo_2016_Appl.Microbiol.Biotechnol_100_1753 |
| | Kim_2005_J.Microbiol_43_285 |
| Comment | Copolymer of Polyhydroxybutyrate (PHB) and polyhydroxypentanoate (PHV). Polyhydroxybutyrate (PHB) is a polyhydroxyalkanoate (PHA) is produced by bacteria ( Ralstonia eutrophus, Methylobacterium rhodesianum or Bacillus megaterium) when nutrients are limited. The poly-3-hydroxybutyrate (P3HB)is the most common type, but other polymers are also produced poly-4-hydroxybutyrate (P4HB), polyhydroxyvalerate (PHV), polyhydroxyhexanoate (PHH), polyhydroxyoctanoate (PHO) and their copolymers. They are used as source of bio-derived and biodegradable plastics. |
| Gene_locus | pseac-q6ufw4 |
| CID | 107801 |
| Family | Esterase_phb |
| | Bacterial_lip_FamI.5 |
| | Extracel-MCL-phaZ |
| InChIKey | IUPHTVOTTBREAV-UHFFFAOYSA-N |
| CanonicalSMILES | CCC(CC(=O)O)O.CC(CC(=O)O)O |
| InChI | InChI=1S/C5H10O3.C4H8O3/c1-2-4(6)3-5(7)8;1-3(5)2-4(6)7/h4,6H,2-3H2,1H3,(H,7,8);3,5H,2H2,1H3,(H,6,7) |
|
|