Substrate Report for: N-formylkynurenine
| N-formylkynurenine | Type | Kynurenine |
|---|
| | Oxobutanoate |
| Other_Name | (S)-2-Amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| | N'-formylkynurenine |
| | (2S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| | N-Formyl-L-kynurenine |
| Chemical_Nomenclature | (2S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| Formula | C11H12N2O4 |
| CAS_number | 3978-11-8 |
| MW | 236.22 |
|  |
| Paper | Han_2012_Biochem.J_446_253 |
| Comment | Kynurenine formamidase (EC:3.5.1.9) catalyses the hydrolysis of N-formyl-L-kynurenine to L-kynurenine, the second step in the kynurenine pathway of tryptophan degradation. |
| Gene_locus | drome-CG9542 |
| | human-AFMID |
| | mouse-KFA |
| | yeast-YDR428C |
| CID | 439788 |
| Family | Kynurenine-formamidase |
| InChIKey | BYHJHXPTQMMKCA-QMMMGPOBSA-N |
| CanonicalSMILES | C1=CC=C(C(=C1)C(=O)CC(C(=O)O)N)NC=O |
| InChI | InChI=1S/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17)/t8-/m0/s1 |
| Wikipedia | N'-formylkynurenine |
|
|
|
