Inhibitor Report for: N-[2-(5-fluoro-1H-indol-3-yl)ethyl]acetamide
N-[2-(5-fluoro-1H-indol-3-yl)ethyl]acetamide | Type | Derivative of Tryptamine |
| | Indole |
| | Not A/B H target |
| Other_Name (5) |
| Chemical_Nomenclature | N-[2-(5-fluoro-1H-indol-3-yl)ethyl]acetamide |
| Formula | C12H13FN2O |
| CAS_number | 2806-01-1 |
| MW | 220.24 |
| |
| Paper | Zhao_2019_J.Pineal.Res__e12630 |
| | Zhao_2021_Future.Med.Chem__ |
| | Zhao_2022_ACS.Chem.Neurosci_13_2060 |
| Structure | 6TR7 |
| Comment | Not a true inhibitor of Notum, Fragment-106 compound 8. derivative of N-Acetylserotonin where hydroxy is replaced by fluor, related to melatonin, fragment hit with poor inhibition IC50 37200 nM compound 14 in Zhao et al 2021 |
| Gene_locus | human-NOTUM |
| CID | 699127 |
| Family | Pectinacetylesterase-Notum |
| InChIKey | UDLASALUJLTGJV-UHFFFAOYSA-N |
| CanonicalSMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)F |
| InChI | InChI=1S/C12H13FN2O/c1-8(16)14-5-4-9-7-15-12-3-2-10(13)6-11(9)12/h2-3,6-7,15H,4-5H2,1H3,(H,14,16) |
|
|