Substrate Report for: Memogain
| Memogain | Type | Derivative of Galanthamine |
|---|
| | Alkaloid |
| | Natural_modified |
| | Benzoate |
| Other_Name | SCHEMBL16885442 |
| | CS-6749 |
| | HY-101710 |
| | Gln-1062 |
| Chemical_Nomenclature | (4aS,6R,8aS)-3-methoxy-11-methyl-4a,5,9,10,11,12-hexahydro-6H-benzo[2,3]benzofuro[4,3-cd]azepin-6-yl benzoate |
| Formula | C24H25NO4 |
| CAS_number | 224169-27-1 |
| MW | 391.46 |
|  |
| Paper | Bhattacharya_2015_J.Alzheimers.Dis_46_123 |
| | Maelicke_2010_J.Mol.Neurosci_40_135 |
| | Baakman_2016_Alzheimers.Dement.(N.Y)_2_13 |
| Comment | Memogain (Gln-1062), a pro-drug, liberates galantamine on cleavage by a carboxyesterase in the brain. Memogain delivered intranasally may further circumvent side effects, allowing higher dosing compared to galantamine and avoid degradation by digestive tract carboxylesterases |
| CID | 44240142 |
| Family | Carb_B_Chordata |
| InChIKey | JKVNJTYHRABHIY-WXVUKLJWSA-N |
| CanonicalSMILES | CN1CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC)OC(=O)C5=CC=CC=C5 |
| InChI | InChI=1S/C24H25NO4/c1-25-13-12-24-11-10-18(28-23(26)16-6-4-3-5-7-16)14-20(24)29-22-19(27-2)9-8-17(15-25)21(22)24/h3-11,18,20H,12-15H2,1-2H3/t18-,20-,24-/m0/s1 |
|
|
|
