Inhibitor Report for: ML226
ML226 | Type | Triazol |
| | Piperidine |
| Other_Name (5) |
| Chemical_Nomenclature | (2-ethylpiperidin-1-yl)-[4-[hydroxy(diphenyl)methyl]triazol-2-yl]methanone |
| Formula | C23H26N4O2 |
| CAS_number | 2055172-43-3 |
| MW | 390.5 |
| |
| Paper | Davda_2014_Medchemcomm_5_268 |
| | Deng_2017_J.Med.Chem_60_428 |
| Comment | Inhibitor of ABHD11 (complete inactivation at 10 nM) and no cross-reactivity with APEH, PAFAH2, or other SHs at 100 nM; IC50 0.03 micro M ABHD11; IC50 0.0631 micro M ABHD11 DAGLA diacylglycerol lipase alpha (2-(methoxymethyl)-piperidine is AA44-2, 2-(ethyl)-piperidie is ML-226) |
| | ABHD11 - abhydrolase domain containing 11 (human) IC50 0.03 microM DAGLA - diacylglycerol lipase alpha (human) IC50 0.0631 microM |
| Gene_locus | human-ABHD11 |
| | human-DAGLA |
| CID | 56593112 |
| Family | ABHD11-Acetyl_transferase |
| | Lipase_3 |
| InChIKey | DGRUIUDIVFCWMX-UHFFFAOYSA-N |
| CanonicalSMILES | CCC1CCCCN1C(=O)N2N=CC(=N2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
| InChI | InChI=1S/C23H26N4O2/c1-2-20-15-9-10-16-26(20)22(28)27-24-17-21(25-27)23(29,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17,20,29H,2,9-10,15-16H2,1H3 |
|
|