Inhibitor Report for: Imipramine
Imipramine | Type | Adrenergic Uptake Inhibitors |
| | Not A/B H target |
| | Drug |
| Other_Name (10) |
| Chemical_Nomenclature | 10,11-Dihydro-N,N-dimethyl-5H-dibenz[b,f]azepine-5propanamine |
| Formula | C19H24N2 |
| CAS_number | 50-49-7 |
| MW | 280.407 |
| |
| Paper | Nag_1995_Ind.J.Exp.Biol_33_462 |
| | Sparks_1994_J.Neuropathol.Exp.Neurol_53_37 |
| | Boopathy_1985_Eur.J.Biochem_151_351 |
| | Boopathy_1987_Eur.J.Biochem_162_191 |
| Comment | Imipramine is the prototypical tricyclic antidepressant. It has been used in major depression, dysthymia, bipolar depression, attention-deficit disorders, agoraphobia, and panic disorders. It has less sedative effect than some other members of this therapeutic group. |
| CID | 3696 |
| Family | BCHE |
| InChIKey | BCGWQEUPMDMJNV-UHFFFAOYSA-N |
| CanonicalSMILES | CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
| InChI | InChI=1S/C19H24N2/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h3-6,8-11H,7,12-15H2,1-2H3 |
| Wikipedia | Imipramine |
|
|