Substrate Report for: Gly-Phe-Glu-Pro
Gly-Phe-Glu-Pro | Type (2) |
| Other_Name | GFEP |
| Chemical_Nomenclature | 1-[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid |
| Formula | C21H28N4O7 |
| MW | 448.47 |
|  |
| Paper | Szeltner_2003_J.Biol.Chem_278_48786 |
| Structure | 1UOP |
| Comment | Derived from bradykinine a natural substrate. derived from Abz-Gly-Phe-Ser-Pro-Phe(NO2)-Ala a fluoerescent synthetic substrate. Gly-Phe-Glu-Pro-Phe(NO2)-Ala is the substrate used but some hydrolysis occurs even with the mutant enzyme and only the n-terminal part is seen in the structure |
| Gene_locus | pig-ppce |
| CID | 18489971 |
| Family | S9N_PPCE_Peptidase_S9 |
| InChIKey | QAZSMZVUAXFMCJ-UHFFFAOYSA-N |
| CanonicalSMILES | C1CC(N(C1)C(=O)C(CCC(=O)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C21H28N4O7/c22-12-17(26)23-15(11-13-5-2-1-3-6-13)19(29)24-14(8-9-18(27)28)20(30)25-10-4-7-16(25)21(31)32/h1-3,5-6,14-16H,4,7-12,22H2,(H,23,26)(H,24,29)(H,27,28)(H,31,32) |
|
|