Substrate Report for: Glu-Phe-Ser-Pro
Glu-Phe-Ser-Pro | Type | Peptide |
| | Pyrrolidine |
| Other_Name | EFSP |
| Chemical_Nomenclature | 1-[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carboxylic acid |
| Formula | C22H30N4O8 |
| MW | 478.50 |
| |
| Paper | Szeltner_2003_J.Biol.Chem_278_48786 |
| Structure | 1UOQ |
| Comment | Derived from bradykinine a natural substrate. derived from Abz-Gly-Phe-Ser-Pro-Phe(NO2)-Ala a fluoerescent synthetic substrate. Glu-Phe-Ser-Pro-Phe(NO2)-Ala is the substrate used but some hydrolysis occurs even with the mutant enzyme and only the n-terminal part is seen in the structure |
| Gene_locus | pig-ppce |
| CID | 22698093 |
| Family | S9N_PPCE_Peptidase_S9 |
| InChIKey | ZHGNQCAJUQNOTB-UHFFFAOYSA-N |
| CanonicalSMILES | C1CC(N(C1)C(=O)C(CO)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CCC(=O)O)N)C(=O)O |
| InChI | InChI=1S/C22H30N4O8/c23-14(8-9-18(28)29)19(30)24-15(11-13-5-2-1-3-6-13)20(31)25-16(12-27)21(32)26-10-4-7-17(26)22(33)34/h1-3,5-6,14-17,27H,4,7-12,23H2,(H,24,30)(H,25,31)(H,28,29)(H,33,34) |
|
|