Inhibitor Report for: Galanthamine
| Galanthamine | Type | Derivative of Galanthamine |
|---|
| | Natural |
| | Alkaloid |
| | Drug |
| Other_Name (6) |
| Chemical_Nomenclature | 1,2,3,4,6,7,7a,11c-octahydro-9-methoxy-2methylbenzofuro[4,3,2-efg][2]benzazocin-6-ol |
| Formula | C17H21NO3 |
| CAS_number | 357-70-0 |
| MW | 287.35 |
|  |
| Paper (38) |
| Structure (5) |
| Comment | Alkaloid from caucasian snow-drop Galenthus woronowii, the common snowdrop Galanthus nivalis Ungernia genus, Amaryllidaceae, from Narcissus spp. Selectivity for AChE. The CAS number of Galanthamine Hydrobromide is 1953-04-4. |
| | Nivalin Reminyl trademark approved for treatment of Alzheimer disease in Austria. |
| | Galantamine is a specific competitive and reversible aceylcholinesterase inhibitor. It is also an allosteric modulator at nicotinic cholinergic receptor sites potentiating cholinergic nicotinic neurotransmission at the ganglionic and the neuromuscular junctions. |
| Gene_locus | torca-ACHE |
| | human-ACHE |
| CID | 9651 |
| Family | ACHE |
| InChIKey | ASUTZQLVASHGKV-JDFRZJQESA-N |
| CanonicalSMILES | CN1CCC23C=CC(CC2OC4=C(C=CC(=C34)C1)OC)O |
| InChI | InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
| IupharLig | 6693 |
| Wikipedia | Galanthamine |
|
|
|
