Inhibitor Report for: Fenthion-oxon
Fenthion-oxon | Type | Insecticide |
| | Organophosphate |
| | Sulfur Compound |
| | Organothiophosphate |
| Other_Name (10) |
| Chemical_Nomenclature | dimethyl (3-methyl-4-methylsulfanylphenyl) phosphate |
| Formula | C10H15O4PS |
| CAS_number | 6552-12-1 |
| MW | 262.26 |
| |
| Paper | Lee_2020_Molecules_25_1938 |
| | Leoni_2008_Toxicol.Appl.Pharmacol_233_343 |
| | Kitamura_2000_Comp.Biochem.Physiol.C.Toxicol.Pharmacol_126_259 |
| Structure | 7P7V |
| Comment | In Australia and the USA, fenthion is used for agricultural purposes and to control cockroaches, crickets, flies, mosquitoes and spiders. It is also present in veterinary drug formulations to control fleas on dogs in Australia, and used as a mosquito adulticide, to control lice, flies, and ticks on cattle and swine or dragonfly larvae in aquaculture Like other organophosphotohionate pesticides fenthion is not active on AChE per se, but it has to be bioactivated: sulfoxidation to fenthion-sulfoxide (FEN-sulfoxide), catalyzed by cytochrome P450 or flavin-containing monooxygenase, and a CYP-mediated oxidative desulfuration to form fenthion-oxon |
| CID | 23046 |
| Family | ACHE |
| InChIKey | ZNRZGJAHNMGWQN-UHFFFAOYSA-N |
| CanonicalSMILES | CC1=C(C=CC(=C1)OP(=O)(OC)OC)SC |
| InChI | InChI=1S/C10H15O4PS/c1-8-7-9(5-6-10(8)16-4)14-15(11,12-2)13-3/h5-7H,1-4H3 |
|
|