Inhibitor Report for: FP-TAMRA
FP-TAMRA | Type | Organophosphate |
| | ABPP-Probe |
| | Benzoate |
| | Xanthene |
| Other_Name | TAMRA-FP |
| Chemical_Nomenclature | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-[10-[ethoxy(fluoro)phosphoryl]decylcarbamoyl]benzoate |
| Formula | C37H47FN3O6P |
| MW | 679,76 |
| |
| Paper | Navia-Paldanius_2012_J.Lipid.Res_53_2413 |
| | Baggelaar_2017_ACS.Chem.Biol_12_852 |
| Comment | Tetramethylrhodamine fluorophosphonate. Serine Hydrolase probe consisting of a tag linked to a fluorophosphonate (FP) group, which specifically and covalently labels serines of enzymatically active serine hydrolases. ABPP-Probe (activity based protein profiling probe) |
| CID | 139035304 |
| InChIKey | JEVJWIYMEMUCFU-UHFFFAOYSA-N |
| CanonicalSMILES | CCOP(=O)(CCCCCCCCCCNC(=O)C1=CC(=C(C=C1)C2=C3C=CC(=[N+](C)C)C=C3OC4=C2C=CC(=C4)N(C)C)C(=O)[O-])F |
| InChI | InChI=1S/C37H47FN3O6P/c1-6-46-48(38,45)22-14-12-10-8-7-9-11-13-21-39-36(42)26-15-18-29(32(23-26)37(43)44)35-30-19-16-27(40(2)3)24-33(30)47-34-25-28(41(4)5)17-20-31(34)35/h15-20,23-25H,6-14,21-22H2,1-5H3,(H-,39,42,43,44) |
|
|