Inhibitor Report for: Eseroline
Eseroline | Type | Derivative of physostigmine-eserine |
| | Indole |
| Other_Name (9) |
| Chemical_Nomenclature | (3aS,8aR)-1,2,3,3a,8,8a-hexahydro-1,3a,8 trimethylpyrrolo[2,3-b]indo l-5-ol |
| Formula | C13H18N2O |
| CAS_number | 469-22-7 |
| MW | 218.295 |
| |
| Paper (9) |
| Comment | An opioid agonist structurally related to physostigmine (eserine) and morphine. Metabolite of Physostigmine/Eserine. A portion of administered cymserine is metabolized in the body into eseroline, a potent mu opioid agonist and neurotoxin |
| CID | 1250 |
| | 119198 |
| Family | ACHE |
| InChIKey | HKGWQUVGHPDEBZ-UHFFFAOYSA-N |
| | HKGWQUVGHPDEBZ-OLZOCXBDSA-N |
| CanonicalSMILES | CC12CCN(C1N(C3=C2C=C(C=C3)O)C)C |
| InChI | InChI=1S/C13H18N2O/c1-13-6-7-14(2)12(13)15(3)11-5-4-9(16)8-10(11)13/h4-5,8,12,16H,6-7H2,1-3H3 |
| | InChI=1S/C13H18N2O/c1-13-6-7-14(2)12(13)15(3)11-5-4-9(16)8-10(11)13/h4-5,8,12,16H,6-7H2,1-3H3/t12-,13+/m1/s1 |
| Wikipedia | Eseroline |
|
|