Inhibitor Report for: Difluorophenyl-pyridin-piperazin-1,3,4-oxadiazole-49
Difluorophenyl-pyridin-piperazin-1,3,4-oxadiazole-49 | Type | Oxadiazol |
| | Pyridine |
| | Piperazine |
| Other_Name | Compound 49 |
| Chemical_Nomenclature | 2-(2,4-difluorophenyl)-5-(4-pyridin-2-ylpiperazin-1-yl)-1,3,4-oxadiazole |
| Formula | C17H15F2N5O |
| MW | 343.12 |
|  |
| Paper | Tripathi_2019_Eur.J.Med.Chem_183_111707 |
| Comment | mixed type of inhibition (Ki = 0.030 microM) (hAChE, IC50 = 0.054 microM), butyrylcholinesterase (hBChE, IC50 = 0.787 microM) and beta-secretase-1 (hBACE-1, IC50 = 0.098 microM). |
| Gene_locus | human-ACHE |
| | human-BCHE |
| CID | 162657748 |
| Family | ACHE |
| | BCHE |
| InChIKey | JDYATWHUSHCNRV-UHFFFAOYSA-N |
| CanonicalSMILES | C1CN(CCN1C2=CC=CC=N2)C3=NN=C(O3)C4=C(C=C(C=C4)F)F |
| InChI | InChI=1S/C17H15F2N5O/c18-12-4-5-13(14(19)11-12)16-21-22-17(25-16)24-9-7-23(8-10-24)15-3-1-2-6-20-15/h1-6,11H,7-10H2 |
|
|