Inhibitor Report for: Dicrotophos
Dicrotophos | Type | Organophosphate |
| | Insecticide |
| Other_Name | (E)-Phosphoric acid 3-(dimethylamino)-1-methyl-3-oxo-1-prophenyl dimethyl ester |
| | (E)-3-(dimethylamino)-1-methyl-3-oxo-1-propenyl dimethyl phosphate |
| | bidrin carbicron ektafos |
| Chemical_Nomenclature | [(E)-4-(dimethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate |
| Formula | C8H16NO5P |
| CAS_number | 141-66-2 |
| Database | Extoxnet | dicrotop |
| MW | 237.21 |
| |
| Paper | Obersteiner_1978_Can.J.Comp.Med_42_80 |
| | Baker_1979_J.S.Afr.Vet.Assoc_50_296 |
| | Fleming_1981_Arch.Environ.Contam.Toxicol_10_215 |
| Comment | Used to control sucking, boring, and chewing pests on rice, cotton, coffee, apples, and other crops. Effective on ornamentals, trees, and shrubs for aphids, leaf hoppers, and scale insects |
| CID | 5371560 |
| Family | ACHE |
| InChIKey | VEENJGZXVHKXNB-VOTSOKGWSA-N |
| CanonicalSMILES | CC(=CC(=O)N(C)C)OP(=O)(OC)OC |
| InChI | InChI=1S/C8H16NO5P/c1-7(6-8(10)9(2)3)14-15(11,12-4)13-5/h6H,1-5H3/b7-6+ |
| Wikipedia | Dicrotophos |
|
|