Inhibitor Report for: D-tubocurarine
D-tubocurarine | Type (5) |
| Other_Name (5) |
| Chemical_Nomenclature | 1',12'-Dihydroxy-6,6'-dimethoxy-2,2'2'-trimethyltubocurarinium chloride |
| Formula | C37H42Cl2N2O6 |
| CAS_number | 6989-98-6 |
| MW | 681.70 |
| |
| Kinetic_parameter (6) |
| Paper (11) |
| Comment | D form isolated from Chondodendron tomentosum (Menispermaceae) the d-form and dimethylether acts as skeletal muscle relaxant Nicotinic. Active ingredient in CURARE. Ligand of small conductance Ca2+-activated K+ (SKca) channels |
| Kin_Inhibitor | D-tubocurarine |
| CID | 6000 |
| Family | ACHE |
| InChIKey | JFJZZMVDLULRGK-URLMMPGGSA-O |
| CanonicalSMILES | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)O)O3)[N+](CCC6=CC(=C5O)OC)(C)C)OC |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-37-35-25(20-34(43-5)36(37)41)13-15-39(2,3)29(35)17-23-8-11-30(40)31(18-23)45-33/h6-11,18-21,28-29H,12-17H2,1-5H3,(H-,40,41)/p+1/t28-,29+/m0/s1 |
| IupharLig | 2294 |
| Wikipedia | Tubocurarine_chloride |
|
|