Substrate Report for: Chlorimuron-methyl
| Chlorimuron-methyl | Type (7) |
|---|
| Other_Name (6) |
| Chemical_Nomenclature | methyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
| Formula | C14H13ClN4O6S |
| CAS_number | 128569-20-0 |
| MW | 400.8 |
|  |
| Paper | Ma_2022_J.Hazard.Mater_443_130197 |
| | Hang_2012_Appl.Environ.Microbiol_78_1962 |
| Comment | Similar to Chlorimuron-ethyl, A proherbicide for chlorimuron, it is used as herbicide for the control of broad-leaved weeds in peanuts, soya beans, and other crops. It is an acetolactate synthase inhibitor. Inhibition of Candida albicans acetohydroxyacid synthase explains fungicide action. |
| Gene_locus | 9entr-CarHBioH |
| CID | 182917 |
| Family | BioH |
| InChIKey | HXGQOVZYUUYUHA-UHFFFAOYSA-N |
| CanonicalSMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC)Cl |
| InChI | InChI=1S/C14H13ClN4O6S/c1-24-11-7-10(15)16-13(17-11)18-14(21)19-26(22,23)9-6-4-3-5-8(9)12(20)25-2/h3-7H,1-2H3,(H2,16,17,18,19,21) |
|
|
|
