Substrate Report for: Beclomethasone-dipropionate
| Beclomethasone-dipropionate | Type | Drug |
|---|
| | Pro-Drug |
| | Not A/B H target |
| | Steroid |
| | Propionate |
| Other_Name | Beclometasone dipropionate |
| | 5534-09-8 |
| | Beclovent |
| | Beconase |
| Chemical_Nomenclature | [2-[(8S,9R,10S,11S,13S,14S,16S,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| Formula | C28H37ClO7 |
| MW | 521.0 |
|  |
| Paper | Qian_2022_Chem.Biol.Interact__110228 |
| Comment | Beclomethasone dipropionate is a second-generation synthetic corticosteroid agent and a diester of beclomethasone, which is structurally similar to [dexamethasone]. It is a prodrug of an active metabolite beclomethasone 17-monopropionate (17-BMP) which acts on the glucocorticoid receptor. anti-inflammatory drug, an anti-asthmatic drug, a prodrug and an anti-arrhythmia drug. Subbstrate of Arylacyl amidase but not of carboxylesterases and cholinesterases. During absorption, beclomethasone dipropionate is undergoes rapid and extensive hydrolysis mediated by esterases CYP3A to form beclomethasone-17-monopropionate (17-BMP) |
| CID | 21700 |
| Family | Arylacetamide_deacetylase |
| InChIKey | KUVIULQEHSCUHY-XYWKZLDCSA-N |
| CanonicalSMILES | CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)Cl)O)C)C)OC(=O)CC |
| InChI | InChI=1S/C28H37ClO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 |
|
|
|
