Inhibitor Report for: Aricept~Donepezil~E2020
| Aricept~Donepezil~E2020 | Type | Derivative of Donepezil |
|---|
| | Piperidine |
| | Drug |
| | Inden |
| Other_Name | Donepezil hydrochloride |
| | DPZ |
| | Donepezilo |
| | Donepezilum |
| | 1-benzyl-4-[(5,6-dimethoxy-1-indanon-2-yl)methyl]piperidine |
| | (+/-)-2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-1H-inden-1-one |
| | Donepezil |
| | E2020 |
| | Aricept |
| Chemical_Nomenclature | 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one;hydrochloride |
| Formula | C24H30ClNO3 |
| CAS_number (2) |
| MW | 415.953 |
|  |
| Paper (54) |
| Structure | 1EVE |
| | 7E3H |
| | 6O4W |
| | 4EY7 |
| Theoretical_model | 3ACE |
| | 4ACE |
| Comment | Treatment of Alzheimer Disease, trademark is Aricept |
| | Reversible inhibitor of AChE but not of BChE |
| Gene_locus | torca-ACHE |
| | human-ACHE |
| CID | 5741 |
| | 3152 |
| Family | ACHE |
| InChIKey | XWAIAVWHZJNZQQ-UHFFFAOYSA-N |
| CanonicalSMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3CCN(CC3)CC4=CC=CC=C4)OC.Cl |
| InChI | InChI=1S/C24H29NO3.ClH/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18;/h3-7,14-15,17,20H,8-13,16H2,1-2H3;1H |
| IupharLig | 6599 |
| Wikipedia | Donepezil |
|
|
|
