Substrate Report for: Acetyl-CoA
Acetyl-CoA | Type | CoA |
| | Aminopurin |
| Other_Name (5) |
| Chemical_Nomenclature | S-[2-[3-[[(2R)-4-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] ethanethioate |
| Formula | C23H38N7O17P3S |
| MW | 809.57 |
| |
| Paper | Nazi_2005_Biochemistry_44_13560 |
| | Lejon_2008_J.Mol.Biol_377_935 |
| | Fiebig_2020_Nat.Commun_11_4723 |
| Structure | 6YUS |
| | 2VAT |
| Comment | Acetyl CoA participates in the biosynthesis of fatty acids and sterols, in the oxidation of fatty acids and in the metabolism of many amino acids. Acetyl-CoA also acts as a biological acetylating agent |
| Gene_locus | cepac-cefg |
| | neime-r0tza2 |
| CID | 444493 |
| Family | Homoserine_transacetylase |
| | AlphaBeta_hydrolase |
| InChIKey | ZSLZBFCDCINBPY-ZSJPKINUSA-N |
| CanonicalSMILES | CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O |
| InChI | InChI=1S/C23H38N7O17P3S/c1-12(31)51-7-6-25-14(32)4-5-26-21(35)18(34)23(2,3)9-44-50(41,42)47-49(39,40)43-8-13-17(46-48(36,37)38)16(33)22(45-13)30-11-29-15-19(24)27-10-28-20(15)30/h10-11,13,16-18,22,33-34H,4-9H2,1-3H3,(H,25,32)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38)/t13-,16-,17-,18+,22-/m1/s1 |
| Wikipedia | Acetyl-CoA |
|
|