Inhibitor Report for: ABX-1431
ABX-1431 | Type | Piperazine |
| | Carbamate |
| | Pyrrolidine |
| | Trifluoro |
| Other_Name (5) |
| Chemical_Nomenclature | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[[2-pyrrolidin-1-yl-4-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| Formula | C20H22F9N3O2 |
| CAS_number | 1446817-84-0 |
| MW | 507.4 |
| |
| Paper (5) |
| Comment | Monoacylglycerol lipase (human-MGLL) inhibitor (IC50 14 nM) .Increases brain 2-AG concentrations, and suppresses pain behavior. ABX-1431 has been shown to reduce tics in patients with Tourette syndrome |
| Gene_locus | human-MGLL |
| CID | 71657619 |
| Family | Monoglyceridelipase_lysophospholip |
| InChIKey | SQZJGTOZFRNWCX-UHFFFAOYSA-N |
| CanonicalSMILES | C1CCN(C1)C2=C(C=CC(=C2)C(F)(F)F)CN3CCN(CC3)C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H22F9N3O2/c21-18(22,23)14-4-3-13(15(11-14)31-5-1-2-6-31)12-30-7-9-32(10-8-30)17(33)34-16(19(24,25)26)20(27,28)29/h3-4,11,16H,1-2,5-10,12H2 |
|
|