Substrate Report for: Undecanoic-acidGeneral | Type | | Natural, Fatty acid | | Chemical_Nomenclature | | undecanoic acid | | Canonical SMILES | | CCCCCCCCCCC(=O)O | | InChI | | InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13) | | InChIKey | | ZDPHROOEEOARMN-UHFFFAOYSA-N
| | Other name(s) | | Hendecanoic acid ; Undecylic acid ; undecanoate ; SCHEMBL9266 ; CHEBI:32368 |
________________________________________________________________________________________________ |
Target | Families | | | Undecanoic-acid ligand of proteins in family: ABHD6-Lip | | Stucture | | | 1 structure: 6I8W: Crystal structure of a membrane phospholipase A from Pseudomonas aeruginosa, a novel bacterial virulence factor | | Protein | | | pseae-PA2949 |
|
