Substrate Report for: 2-MethoxyethylacetateGeneral | Type | | Acetate | | Chemical_Nomenclature | | 2-methoxyethyl acetate | | Canonical SMILES | | CC(=O)OCCOC | | InChI | | InChI=1S/C5H10O3/c1-5(6)8-4-3-7-2/h3-4H2,1-2H3 | | InChIKey | | XLLIQLLCWZCATF-UHFFFAOYSA-N
| | Other name(s) | | 2-Methoxyethyl acetate ; Methyl glycol acetate ; Acetic acid 2-methoxyethyl ester ; MeCsac ; Ethylene glycol monomethyl ether acetate |
________________________________________________________________________________________________ |
Target | Families | | | 2-Methoxyethylacetate ligand of proteins in family: ACHE |
References:
Title: Hydrolysis by acetylcholinesterase. Apparent molal volumes and trimethyl and methyl subsites
Hasan FB, Cohen SG, Cohen JB
Ref: Journal of Biological Chemistry, 255:3898, 1980 : PubMed
 eleel-ACHE
WT Kinetics
|
