Substrate Report for: 2-ChloroethylacetateGeneral | Type | | Acetate, Haloacetate | | Chemical_Nomenclature | | 2-chloroethyl acetate | | Canonical SMILES | | CC(=O)OCCCl | | InChI | | InChI=1S/C4H7ClO2/c1-4(6)7-3-2-5/h2-3H2,1H3 | | InChIKey | | VIRWKAJWTKAIMA-UHFFFAOYSA-N
| | Other name(s) | | 2-Chloroethyl acetate ; Acetic Acid 2-Chloroethyl Ester ; 2-Acetoxyethyl chloride ; 2-Chloroethyl ethanoate ; Ethanol, 2-chloro-, acetate |
________________________________________________________________________________________________ |
Target | Families | | | 2-Chloroethylacetate ligand of proteins in family: ACHE |
References:
Title: Hydrolysis by acetylcholinesterase. Apparent molal volumes and trimethyl and methyl subsites
Hasan FB, Cohen SG, Cohen JB
Ref: Journal of Biological Chemistry, 255:3898, 1980 : PubMed
 eleel-ACHE
WT Kinetics
|
