Substrate Report for: 2-HydroxyethylacetateGeneral | Type | | Acetate | | Chemical_Nomenclature | | 2-hydroxyethyl acetate | | Canonical SMILES | | CC(=O)OCCO | | InChI | | InChI=1S/C4H8O3/c1-4(6)7-3-2-5/h5H,2-3H2,1H3 | | InChIKey | | HXDLWJWIAHWIKI-UHFFFAOYSA-N
| | Other name(s) | | 2-Hydroxyethyl acetate ; 2-Acetoxyethanol ; Ethylene glycol monoacetate ; Ethylene glycol, monoacetate ; 1,2-Ethanediol, monoacetate |
________________________________________________________________________________________________ |
Target | Families | | | 2-Hydroxyethylacetate ligand of proteins in family: ACHE |
References:
Title: Hydrolysis by acetylcholinesterase. Apparent molal volumes and trimethyl and methyl subsites
Hasan FB, Cohen SG, Cohen JB
Ref: Journal of Biological Chemistry, 255:3898, 1980 : PubMed
 eleel-ACHE
WT Kinetics
|
