Inhibitor Report for: 2-(1,2-Dihydroacenaphthylen-5-ylsulfanyl)acetic-acidGeneral Type | | Fragment inhibitor of Notum, Naphthalen, Sulfur Compound | Chemical_Nomenclature | | 2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid | Canonical SMILES | | C1CC2=CC=C(C3=CC=CC1=C23)SCC(=O)O | InChI | | InChI=1S/C14H12O2S/c15-13(16)8-17-12-7-6-10-5-4-9-2-1-3-11(12)14(9)10/h1-3,6-7H,4-5,8H2,(H,15,16) | InChIKey | | ILIYQPKGPUGGBV-UHFFFAOYSA-N
| Other name(s) | | 2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid ; Enamine_005563 ; HMS1409M19 ; ZINC3315933 ; fragment_126 ; U5B |
________________________________________________________________________________________________ |
Target Families | | | 2-(1,2-Dihydroacenaphthylen-5-ylsulfanyl)acetic-acid ligand of proteins in family: Pectinacetylesterase-Notum | Stucture | | | 1 structure: 7BNC: Human Notum complexed with fragment_126 (2-(1,2-dihydroacenaphthylen-5-ylsulfanyl)acetic acid) | Protein | | | human-NOTUM |
|